C12H18O9 — CID 141451459
(3R,4R,5R)-3,4-diacetyl-3,4,5,6-tetrahydroxy-7-oxooctanoic acid (PubChem CID 141451459) has the molecular formula C12H18O9 and a molecular weight of 306.27 g/mol. Its IUPAC name is (3R,4R,5R)-3,4-diacetyl-3,4,5,6-tetrahydroxy-7-oxooctanoic acid.
| Compound Name | (3R,4R,5R)-3,4-diacetyl-3,4,5,6-tetrahydroxy-7-oxooctanoic acid |
|---|---|
| PubChem CID | 141451459 |
| Molecular Formula | C12H18O9 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3R,4R,5R)-3,4-diacetyl-3,4,5,6-tetrahydroxy-7-oxooctanoic acid |
| SMILES | CC(=O)C(O)[C@@H](O)[C@](O)(C(C)=O)[C@](O)(CC(=O)O)C(C)=O |
| InChI | InChI=1S/C12H18O9/c1-5(13)9(18)10(19)12(21,7(3)15)11(20,6(2)14)4-8(16)17/h9-10,18-21H,4H2,1-3H3,(H,16,17)/t9?,10-,11+,12-/m1/s1 |
| InChIKey | KPQGIJVTPZBJAY-FGNRJIRKSA-N |
| XLogP | -2.59 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |