C12H18O7 — CID 154634441
(2R,3S,4R)-3-acetyl-3,4,5-trihydroxy-6-oxo-2-(2-oxopropyl)heptanal (PubChem CID 154634441) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is (2R,3S,4R)-3-acetyl-3,4,5-trihydroxy-6-oxo-2-(2-oxopropyl)heptanal.
| Compound Name | (2R,3S,4R)-3-acetyl-3,4,5-trihydroxy-6-oxo-2-(2-oxopropyl)heptanal |
|---|---|
| PubChem CID | 154634441 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (2R,3S,4R)-3-acetyl-3,4,5-trihydroxy-6-oxo-2-(2-oxopropyl)heptanal |
| SMILES | CC(=O)C[C@@H](C=O)[C@@](O)(C(C)=O)[C@H](O)C(O)C(C)=O |
| InChI | InChI=1S/C12H18O7/c1-6(14)4-9(5-13)12(19,8(3)16)11(18)10(17)7(2)15/h5,9-11,17-19H,4H2,1-3H3/t9-,10?,11+,12-/m0/s1 |
| InChIKey | LGBKLNNJYUXINC-BEZGRXCVSA-N |
| XLogP | -1.59 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|