About 2-acetyl-4-oxopentanal
2-acetyl-4-oxopentanal (PubChem CID 87449777) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 2-acetyl-4-oxopentanal.
Molecular Properties
| Compound Name | 2-acetyl-4-oxopentanal |
| PubChem CID | 87449777 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 2-acetyl-4-oxopentanal |
| SMILES | CC(=O)CC(C=O)C(C)=O |
| InChI | InChI=1S/C7H10O3/c1-5(9)3-7(4-8)6(2)10/h4,7H,3H2,1-2H3 |
| InChIKey | SAEWBWHBHINFDX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-4-oxopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-4-oxopentanal?
The IUPAC name of 2-acetyl-4-oxopentanal (CID 87449777) is 2-acetyl-4-oxopentanal.
What is the SMILES notation for 2-acetyl-4-oxopentanal?
The canonical SMILES for 2-acetyl-4-oxopentanal is CC(=O)CC(C=O)C(C)=O.
What is the InChIKey of 2-acetyl-4-oxopentanal?
The InChIKey is SAEWBWHBHINFDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-5(9)3-7(4-8)6(2)10/h4,7H,3H2,1-2H3.
What are the key properties of 2-acetyl-4-oxopentanal?
2-acetyl-4-oxopentanal has a molecular weight of 142.15 g/mol, XLogP of 0.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-4-oxopentanal is sourced from PubChem (CID 87449777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).