About formyl 2-formyl-4-oxopentanoate
formyl 2-formyl-4-oxopentanoate (PubChem CID 87602420) has the molecular formula C7H8O5
and a molecular weight of 172.14 g/mol. Its IUPAC name is formyl 2-formyl-4-oxopentanoate.
Molecular Properties
| Compound Name | formyl 2-formyl-4-oxopentanoate |
| PubChem CID | 87602420 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | formyl 2-formyl-4-oxopentanoate |
| SMILES | CC(=O)CC(C=O)C(=O)OC=O |
| InChI | InChI=1S/C7H8O5/c1-5(10)2-6(3-8)7(11)12-4-9/h3-4,6H,2H2,1H3 |
| InChIKey | MIXISEPFSNICEG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze formyl 2-formyl-4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl 2-formyl-4-oxopentanoate?
The IUPAC name of formyl 2-formyl-4-oxopentanoate (CID 87602420) is formyl 2-formyl-4-oxopentanoate.
What is the SMILES notation for formyl 2-formyl-4-oxopentanoate?
The canonical SMILES for formyl 2-formyl-4-oxopentanoate is CC(=O)CC(C=O)C(=O)OC=O.
What is the InChIKey of formyl 2-formyl-4-oxopentanoate?
The InChIKey is MIXISEPFSNICEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O5/c1-5(10)2-6(3-8)7(11)12-4-9/h3-4,6H,2H2,1H3.
What are the key properties of formyl 2-formyl-4-oxopentanoate?
formyl 2-formyl-4-oxopentanoate has a molecular weight of 172.14 g/mol, XLogP of -0.52, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formyl 2-formyl-4-oxopentanoate is sourced from PubChem (CID 87602420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).