2-formylbutanoic acid

C5H8O3 — CID 13470445

IUPAC2-formylbutanoic acid
SMILESCCC(C=O)C(=O)O
InChIInChI=1S/C5H8O3/c1-2-4(3-6)5(7)8/h3-4H,2H2,1H3,(H,7,8)
InChIKeyFKJHLNDJJGVDEE-UHFFFAOYSA-N
MW116.12 g/mol
LogP0.30
Rot. Bonds3

About 2-formylbutanoic acid

2-formylbutanoic acid (PubChem CID 13470445) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is 2-formylbutanoic acid.

Molecular Properties

Compound Name2-formylbutanoic acid
PubChem CID13470445
Molecular FormulaC5H8O3
Molecular Weight116.12 g/mol
Exact Mass116.05
IUPAC Name2-formylbutanoic acid
SMILESCCC(C=O)C(=O)O
InChIInChI=1S/C5H8O3/c1-2-4(3-6)5(7)8/h3-4H,2H2,1H3,(H,7,8)
InChIKeyFKJHLNDJJGVDEE-UHFFFAOYSA-N
XLogP0.30
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500116.12
LogP ≤ 50.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-formylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-formylbutanoic acid?
The IUPAC name of 2-formylbutanoic acid (CID 13470445) is 2-formylbutanoic acid.
What is the SMILES notation for 2-formylbutanoic acid?
The canonical SMILES for 2-formylbutanoic acid is CCC(C=O)C(=O)O.
What is the InChIKey of 2-formylbutanoic acid?
The InChIKey is FKJHLNDJJGVDEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3/c1-2-4(3-6)5(7)8/h3-4H,2H2,1H3,(H,7,8).
What are the key properties of 2-formylbutanoic acid?
2-formylbutanoic acid has a molecular weight of 116.12 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formylbutanoic acid is sourced from PubChem (CID 13470445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).