About 2-formylbutanoyl chloride
2-formylbutanoyl chloride (PubChem CID 23185799) has the molecular formula C5H7ClO2
and a molecular weight of 134.56 g/mol. Its IUPAC name is 2-formylbutanoyl chloride.
Molecular Properties
| Compound Name | 2-formylbutanoyl chloride |
| PubChem CID | 23185799 |
| Molecular Formula | C5H7ClO2 |
| Molecular Weight | 134.56 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | 2-formylbutanoyl chloride |
| SMILES | CCC(C=O)C(=O)Cl |
| InChI | InChI=1S/C5H7ClO2/c1-2-4(3-7)5(6)8/h3-4H,2H2,1H3 |
| InChIKey | JPBXGSJDHQXTPQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.56 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-formylbutanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formylbutanoyl chloride?
The IUPAC name of 2-formylbutanoyl chloride (CID 23185799) is 2-formylbutanoyl chloride.
What is the SMILES notation for 2-formylbutanoyl chloride?
The canonical SMILES for 2-formylbutanoyl chloride is CCC(C=O)C(=O)Cl.
What is the InChIKey of 2-formylbutanoyl chloride?
The InChIKey is JPBXGSJDHQXTPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClO2/c1-2-4(3-7)5(6)8/h3-4H,2H2,1H3.
What are the key properties of 2-formylbutanoyl chloride?
2-formylbutanoyl chloride has a molecular weight of 134.56 g/mol, XLogP of 0.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formylbutanoyl chloride is sourced from PubChem (CID 23185799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).