About 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal
2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal (PubChem CID 175828344) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal.
Molecular Properties
| Compound Name | 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal |
| PubChem CID | 175828344 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal |
| SMILES | CCC(C=O)C(=O)C(C)(O)C(C)O |
| InChI | InChI=1S/C9H16O4/c1-4-7(5-10)8(12)9(3,13)6(2)11/h5-7,11,13H,4H2,1-3H3 |
| InChIKey | NMBQGCXAPLFYRV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal?
The IUPAC name of 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal (CID 175828344) is 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal.
What is the SMILES notation for 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal?
The canonical SMILES for 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal is CCC(C=O)C(=O)C(C)(O)C(C)O.
What is the InChIKey of 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal?
The InChIKey is NMBQGCXAPLFYRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-4-7(5-10)8(12)9(3,13)6(2)11/h5-7,11,13H,4H2,1-3H3.
What are the key properties of 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal?
2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal has a molecular weight of 188.22 g/mol, XLogP of -0.09, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,5-dihydroxy-4-methyl-3-oxohexanal is sourced from PubChem (CID 175828344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).