About 2-ethyl-3-iminobutanal
2-ethyl-3-iminobutanal (PubChem CID 123144543) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-ethyl-3-iminobutanal.
Molecular Properties
| Compound Name | 2-ethyl-3-iminobutanal |
| PubChem CID | 123144543 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2-ethyl-3-iminobutanal |
| SMILES | [H]/N=C(\C)C(C=O)CC |
| InChI | InChI=1S/C6H11NO/c1-3-6(4-8)5(2)7/h4,6-7H,3H2,1-2H3/b7-5+ |
| InChIKey | ASRQUFHADVBNOR-FNORWQNLSA-N |
| XLogP | 1.25 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3-iminobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-iminobutanal?
The IUPAC name of 2-ethyl-3-iminobutanal (CID 123144543) is 2-ethyl-3-iminobutanal.
What is the SMILES notation for 2-ethyl-3-iminobutanal?
The canonical SMILES for 2-ethyl-3-iminobutanal is [H]/N=C(\C)C(C=O)CC.
What is the InChIKey of 2-ethyl-3-iminobutanal?
The InChIKey is ASRQUFHADVBNOR-FNORWQNLSA-N. The full InChI is InChI=1S/C6H11NO/c1-3-6(4-8)5(2)7/h4,6-7H,3H2,1-2H3/b7-5+.
What are the key properties of 2-ethyl-3-iminobutanal?
2-ethyl-3-iminobutanal has a molecular weight of 113.16 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-iminobutanal is sourced from PubChem (CID 123144543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).