About 2-ethyl-3-oxobutanedial
2-ethyl-3-oxobutanedial (PubChem CID 172742437) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-ethyl-3-oxobutanedial.
Molecular Properties
| Compound Name | 2-ethyl-3-oxobutanedial |
| PubChem CID | 172742437 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 2-ethyl-3-oxobutanedial |
| SMILES | CCC(C=O)C(=O)C=O |
| InChI | InChI=1S/C6H8O3/c1-2-5(3-7)6(9)4-8/h3-5H,2H2,1H3 |
| InChIKey | JGXSPLBUFTXVBT-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3-oxobutanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-oxobutanedial?
The IUPAC name of 2-ethyl-3-oxobutanedial (CID 172742437) is 2-ethyl-3-oxobutanedial.
What is the SMILES notation for 2-ethyl-3-oxobutanedial?
The canonical SMILES for 2-ethyl-3-oxobutanedial is CCC(C=O)C(=O)C=O.
What is the InChIKey of 2-ethyl-3-oxobutanedial?
The InChIKey is JGXSPLBUFTXVBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c1-2-5(3-7)6(9)4-8/h3-5H,2H2,1H3.
What are the key properties of 2-ethyl-3-oxobutanedial?
2-ethyl-3-oxobutanedial has a molecular weight of 128.13 g/mol, XLogP of -0.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-oxobutanedial is sourced from PubChem (CID 172742437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).