About 2-acetylhexanal
2-acetylhexanal (PubChem CID 12612516) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-acetylhexanal.
Molecular Properties
| Compound Name | 2-acetylhexanal |
| PubChem CID | 12612516 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-acetylhexanal |
| SMILES | CCCCC(C=O)C(C)=O |
| InChI | InChI=1S/C8H14O2/c1-3-4-5-8(6-9)7(2)10/h6,8H,3-5H2,1-2H3 |
| InChIKey | WSGFQESEXWMXEK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-acetylhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetylhexanal?
The IUPAC name of 2-acetylhexanal (CID 12612516) is 2-acetylhexanal.
What is the SMILES notation for 2-acetylhexanal?
The canonical SMILES for 2-acetylhexanal is CCCCC(C=O)C(C)=O.
What is the InChIKey of 2-acetylhexanal?
The InChIKey is WSGFQESEXWMXEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-4-5-8(6-9)7(2)10/h6,8H,3-5H2,1-2H3.
What are the key properties of 2-acetylhexanal?
2-acetylhexanal has a molecular weight of 142.20 g/mol, XLogP of 1.58, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetylhexanal is sourced from PubChem (CID 12612516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).