About ethyl 2-formylheptanoate
ethyl 2-formylheptanoate (PubChem CID 13330717) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is ethyl 2-formylheptanoate.
Molecular Properties
| Compound Name | ethyl 2-formylheptanoate |
| PubChem CID | 13330717 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | ethyl 2-formylheptanoate |
| SMILES | CCCCCC(C=O)C(=O)OCC |
| InChI | InChI=1S/C10H18O3/c1-3-5-6-7-9(8-11)10(12)13-4-2/h8-9H,3-7H2,1-2H3 |
| InChIKey | CAETZEKKUMPNRC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-formylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-formylheptanoate?
The IUPAC name of ethyl 2-formylheptanoate (CID 13330717) is ethyl 2-formylheptanoate.
What is the SMILES notation for ethyl 2-formylheptanoate?
The canonical SMILES for ethyl 2-formylheptanoate is CCCCCC(C=O)C(=O)OCC.
What is the InChIKey of ethyl 2-formylheptanoate?
The InChIKey is CAETZEKKUMPNRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-3-5-6-7-9(8-11)10(12)13-4-2/h8-9H,3-7H2,1-2H3.
What are the key properties of ethyl 2-formylheptanoate?
ethyl 2-formylheptanoate has a molecular weight of 186.25 g/mol, XLogP of 1.94, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-formylheptanoate is sourced from PubChem (CID 13330717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).