C12H23O8P — CID 89255870
(2-hydroxy-3-phosphonooxypropyl) 2-formyloctanoate (PubChem CID 89255870) has the molecular formula C12H23O8P and a molecular weight of 326.28 g/mol. Its IUPAC name is (2-hydroxy-3-phosphonooxypropyl) 2-formyloctanoate.
| Compound Name | (2-hydroxy-3-phosphonooxypropyl) 2-formyloctanoate |
|---|---|
| PubChem CID | 89255870 |
| Molecular Formula | C12H23O8P |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (2-hydroxy-3-phosphonooxypropyl) 2-formyloctanoate |
| SMILES | CCCCCCC(C=O)C(=O)OCC(O)COP(=O)(O)O |
| InChI | InChI=1S/C12H23O8P/c1-2-3-4-5-6-10(7-13)12(15)19-8-11(14)9-20-21(16,17)18/h7,10-11,14H,2-6,8-9H2,1H3,(H2,16,17,18) |
| InChIKey | IUAVPCWFPZRYCP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|