C21H39O7P — CID 173209111
(2-hydroxy-3-phosphonooxypropyl) octadeca-2,12-dienoate (PubChem CID 173209111) has the molecular formula C21H39O7P and a molecular weight of 434.51 g/mol. Its IUPAC name is (2-hydroxy-3-phosphonooxypropyl) octadeca-2,12-dienoate.
| Compound Name | (2-hydroxy-3-phosphonooxypropyl) octadeca-2,12-dienoate |
|---|---|
| PubChem CID | 173209111 |
| Molecular Formula | C21H39O7P |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | (2-hydroxy-3-phosphonooxypropyl) octadeca-2,12-dienoate |
| SMILES | CCCCCC=CCCCCCCCCC=CC(=O)OCC(O)COP(=O)(O)O |
| InChI | InChI=1S/C21H39O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)27-18-20(22)19-28-29(24,25)26/h6-7,16-17,20,22H,2-5,8-15,18-19H2,1H3,(H2,24,25,26) |
| InChIKey | NBDWVSBHUGVOIS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|