C15H29O7P — CID 126502331
[(2S)-2-hydroxy-3-phosphonooxypropyl] (Z)-5-methylundec-3-enoate (PubChem CID 126502331) has the molecular formula C15H29O7P and a molecular weight of 352.36 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-phosphonooxypropyl] (Z)-5-methylundec-3-enoate.
| Compound Name | [(2S)-2-hydroxy-3-phosphonooxypropyl] (Z)-5-methylundec-3-enoate |
|---|---|
| PubChem CID | 126502331 |
| Molecular Formula | C15H29O7P |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [(2S)-2-hydroxy-3-phosphonooxypropyl] (Z)-5-methylundec-3-enoate |
| SMILES | CCCCCCC(C)/C=C\CC(=O)OC[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C15H29O7P/c1-3-4-5-6-8-13(2)9-7-10-15(17)21-11-14(16)12-22-23(18,19)20/h7,9,13-14,16H,3-6,8,10-12H2,1-2H3,(H2,18,19,20)/b9-7-/t13?,14-/m0/s1 |
| InChIKey | AYHBWQPFRWSWRL-DPGPRNPXSA-N |
| XLogP | 2.55 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|