C21H39O9P — CID 11328797
(2-hydroxy-3-phosphonooxypropyl) (10E,12Z)-9-hydroperoxyoctadeca-10,12-dienoate (PubChem CID 11328797) has the molecular formula C21H39O9P and a molecular weight of 466.51 g/mol. Its IUPAC name is (2-hydroxy-3-phosphonooxypropyl) (10E,12Z)-9-hydroperoxyoctadeca-10,12-dienoate.
| Compound Name | (2-hydroxy-3-phosphonooxypropyl) (10E,12Z)-9-hydroperoxyoctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 11328797 |
| Molecular Formula | C21H39O9P |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | (2-hydroxy-3-phosphonooxypropyl) (10E,12Z)-9-hydroperoxyoctadeca-10,12-dienoate |
| SMILES | CCCCC/C=C\C=C\C(CCCCCCCC(=O)OCC(O)COP(=O)(O)O)OO |
| InChI | InChI=1S/C21H39O9P/c1-2-3-4-5-6-8-11-14-20(30-24)15-12-9-7-10-13-16-21(23)28-17-19(22)18-29-31(25,26)27/h6,8,11,14,19-20,22,24H,2-5,7,9-10,12-13,15-18H2,1H3,(H2,25,26,27)/b8-6-,14-11+ |
| InChIKey | TVUIUMUOOMUQNQ-ZJHFMPGASA-N |
| XLogP | 4.28 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|