C21H35O7P — CID 54505839
(2-hydroxy-3-phosphonooxypropyl) octadeca-10,12-diynoate (PubChem CID 54505839) has the molecular formula C21H35O7P and a molecular weight of 430.48 g/mol. Its IUPAC name is (2-hydroxy-3-phosphonooxypropyl) octadeca-10,12-diynoate.
| Compound Name | (2-hydroxy-3-phosphonooxypropyl) octadeca-10,12-diynoate |
|---|---|
| PubChem CID | 54505839 |
| Molecular Formula | C21H35O7P |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (2-hydroxy-3-phosphonooxypropyl) octadeca-10,12-diynoate |
| SMILES | CCCCCC#CC#CCCCCCCCCC(=O)OCC(O)COP(=O)(O)O |
| InChI | InChI=1S/C21H35O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)27-18-20(22)19-28-29(24,25)26/h20,22H,2-5,10-19H2,1H3,(H2,24,25,26) |
| InChIKey | YFQCRJCVXULAHR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|