About 2-butanoyl-4-oxoheptanal
2-butanoyl-4-oxoheptanal (PubChem CID 59686611) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 2-butanoyl-4-oxoheptanal.
Molecular Properties
| Compound Name | 2-butanoyl-4-oxoheptanal |
| PubChem CID | 59686611 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2-butanoyl-4-oxoheptanal |
| SMILES | CCCC(=O)CC(C=O)C(=O)CCC |
| InChI | InChI=1S/C11H18O3/c1-3-5-10(13)7-9(8-12)11(14)6-4-2/h8-9H,3-7H2,1-2H3 |
| InChIKey | LCRGSNUKGMAINS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-butanoyl-4-oxoheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butanoyl-4-oxoheptanal?
The IUPAC name of 2-butanoyl-4-oxoheptanal (CID 59686611) is 2-butanoyl-4-oxoheptanal.
What is the SMILES notation for 2-butanoyl-4-oxoheptanal?
The canonical SMILES for 2-butanoyl-4-oxoheptanal is CCCC(=O)CC(C=O)C(=O)CCC.
What is the InChIKey of 2-butanoyl-4-oxoheptanal?
The InChIKey is LCRGSNUKGMAINS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-3-5-10(13)7-9(8-12)11(14)6-4-2/h8-9H,3-7H2,1-2H3.
What are the key properties of 2-butanoyl-4-oxoheptanal?
2-butanoyl-4-oxoheptanal has a molecular weight of 198.26 g/mol, XLogP of 1.93, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butanoyl-4-oxoheptanal is sourced from PubChem (CID 59686611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).