About azane;formyl acetate
azane;formyl acetate (PubChem CID 87373456) has the molecular formula C3H7NO3
and a molecular weight of 105.09 g/mol. Its IUPAC name is azane;formyl acetate.
Molecular Properties
| Compound Name | azane;formyl acetate |
| PubChem CID | 87373456 |
| Molecular Formula | C3H7NO3 |
| Molecular Weight | 105.09 g/mol |
| Exact Mass | 105.04 |
| IUPAC Name | azane;formyl acetate |
| SMILES | CC(=O)OC=O.N |
| InChI | InChI=1S/C3H4O3.H3N/c1-3(5)6-2-4;/h2H,1H3;1H3 |
| InChIKey | MQNXECQMJRINJM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.09 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azane;formyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;formyl acetate?
The IUPAC name of azane;formyl acetate (CID 87373456) is azane;formyl acetate.
What is the SMILES notation for azane;formyl acetate?
The canonical SMILES for azane;formyl acetate is CC(=O)OC=O.N.
What is the InChIKey of azane;formyl acetate?
The InChIKey is MQNXECQMJRINJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O3.H3N/c1-3(5)6-2-4;/h2H,1H3;1H3.
What are the key properties of azane;formyl acetate?
azane;formyl acetate has a molecular weight of 105.09 g/mol, XLogP of -0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;formyl acetate is sourced from PubChem (CID 87373456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).