About acetonitrile;azane;formyl acetate
acetonitrile;azane;formyl acetate (PubChem CID 174795258) has the molecular formula C5H10N2O3
and a molecular weight of 146.15 g/mol. Its IUPAC name is acetonitrile;azane;formyl acetate.
Molecular Properties
| Compound Name | acetonitrile;azane;formyl acetate |
| PubChem CID | 174795258 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | acetonitrile;azane;formyl acetate |
| SMILES | CC#N.CC(=O)OC=O.N |
| InChI | InChI=1S/C3H4O3.C2H3N.H3N/c1-3(5)6-2-4;1-2-3;/h2H,1H3;1H3;1H3 |
| InChIKey | KSLHJIPVWMVBSW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;azane;formyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;azane;formyl acetate?
The IUPAC name of acetonitrile;azane;formyl acetate (CID 174795258) is acetonitrile;azane;formyl acetate.
What is the SMILES notation for acetonitrile;azane;formyl acetate?
The canonical SMILES for acetonitrile;azane;formyl acetate is CC#N.CC(=O)OC=O.N.
What is the InChIKey of acetonitrile;azane;formyl acetate?
The InChIKey is KSLHJIPVWMVBSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O3.C2H3N.H3N/c1-3(5)6-2-4;1-2-3;/h2H,1H3;1H3;1H3.
What are the key properties of acetonitrile;azane;formyl acetate?
acetonitrile;azane;formyl acetate has a molecular weight of 146.15 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;azane;formyl acetate is sourced from PubChem (CID 174795258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).