C18H27NO10 — CID 22842147
N-[(4R,5R,6S,7R)-5,6-diacetyl-5,6,7,8-tetrahydroxy-2,3,9-trioxodecan-4-yl]butanamide (PubChem CID 22842147) has the molecular formula C18H27NO10 and a molecular weight of 417.41 g/mol. Its IUPAC name is N-[(4R,5R,6S,7R)-5,6-diacetyl-5,6,7,8-tetrahydroxy-2,3,9-trioxodecan-4-yl]butanamide.
| Compound Name | N-[(4R,5R,6S,7R)-5,6-diacetyl-5,6,7,8-tetrahydroxy-2,3,9-trioxodecan-4-yl]butanamide |
|---|---|
| PubChem CID | 22842147 |
| Molecular Formula | C18H27NO10 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-[(4R,5R,6S,7R)-5,6-diacetyl-5,6,7,8-tetrahydroxy-2,3,9-trioxodecan-4-yl]butanamide |
| SMILES | CCCC(=O)N[C@@H](C(=O)C(C)=O)[C@](O)(C(C)=O)[C@](O)(C(C)=O)[C@H](O)C(O)C(C)=O |
| InChI | InChI=1S/C18H27NO10/c1-6-7-12(24)19-15(13(25)8(2)20)17(28,10(4)22)18(29,11(5)23)16(27)14(26)9(3)21/h14-16,26-29H,6-7H2,1-5H3,(H,19,24)/t14?,15-,16+,17+,18-/m0/s1 |
| InChIKey | PHQLCWKJKHAZPT-WBUQSJCKSA-N |
| XLogP | -2.62 |
| TPSA | 195.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|