C8H16O3 — CID 131860482
(3R,4R)-3,4-dihydroxy-3,5-dimethylhexan-2-one (PubChem CID 131860482) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (3R,4R)-3,4-dihydroxy-3,5-dimethylhexan-2-one.
| Compound Name | (3R,4R)-3,4-dihydroxy-3,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 131860482 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (3R,4R)-3,4-dihydroxy-3,5-dimethylhexan-2-one |
| SMILES | CC(=O)[C@](C)(O)[C@H](O)C(C)C |
| InChI | InChI=1S/C8H16O3/c1-5(2)7(10)8(4,11)6(3)9/h5,7,10-11H,1-4H3/t7-,8+/m1/s1 |
| InChIKey | AIUXVDCAPTYWHZ-SFYZADRCSA-N |
| XLogP | 0.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |