C12H24O5 — CID 146303073
acetyl acetate;2,2,4-trimethylpentane-1,3-diol (PubChem CID 146303073) has the molecular formula C12H24O5 and a molecular weight of 248.32 g/mol. Its IUPAC name is acetyl acetate;2,2,4-trimethylpentane-1,3-diol.
| Compound Name | acetyl acetate;2,2,4-trimethylpentane-1,3-diol |
|---|---|
| PubChem CID | 146303073 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | acetyl acetate;2,2,4-trimethylpentane-1,3-diol |
| SMILES | CC(=O)OC(C)=O.CC(C)C(O)C(C)(C)CO |
| InChI | InChI=1S/C8H18O2.C4H6O3/c1-6(2)7(10)8(3,4)5-9;1-3(5)7-4(2)6/h6-7,9-10H,5H2,1-4H3;1-2H3 |
| InChIKey | NQAVXVICDMOPTM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|