C16H24O6 — CID 86754841
phthalic acid;2,2,4-trimethylpentane-1,3-diol (PubChem CID 86754841) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is phthalic acid;2,2,4-trimethylpentane-1,3-diol.
| Compound Name | phthalic acid;2,2,4-trimethylpentane-1,3-diol |
|---|---|
| PubChem CID | 86754841 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | phthalic acid;2,2,4-trimethylpentane-1,3-diol |
| SMILES | CC(C)C(O)C(C)(C)CO.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.C8H18O2/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-6(2)7(10)8(3,4)5-9/h1-4H,(H,9,10)(H,11,12);6-7,9-10H,5H2,1-4H3 |
| InChIKey | KGNIIRKHIYIMMM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |