C24H42O8 — CID 70478069
benzene-1,3-dicarboxylic acid;bis(2,2,4-trimethylpentane-1,3-diol) (PubChem CID 70478069) has the molecular formula C24H42O8 and a molecular weight of 458.59 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;bis(2,2,4-trimethylpentane-1,3-diol).
| Compound Name | benzene-1,3-dicarboxylic acid;bis(2,2,4-trimethylpentane-1,3-diol) |
|---|---|
| PubChem CID | 70478069 |
| Molecular Formula | C24H42O8 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;bis(2,2,4-trimethylpentane-1,3-diol) |
| SMILES | CC(C)C(O)C(C)(C)CO.CC(C)C(O)C(C)(C)CO.O=C(O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H6O4.2C8H18O2/c9-7(10)5-2-1-3-6(4-5)8(11)12;2*1-6(2)7(10)8(3,4)5-9/h1-4H,(H,9,10)(H,11,12);2*6-7,9-10H,5H2,1-4H3 |
| InChIKey | GAGCRXHDYZOCNA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |