C22H38O8 — CID 70538106
benzene-1,3-dicarboxylic acid;bis(4-methylhexane-1,1-diol) (PubChem CID 70538106) has the molecular formula C22H38O8 and a molecular weight of 430.54 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;bis(4-methylhexane-1,1-diol).
| Compound Name | benzene-1,3-dicarboxylic acid;bis(4-methylhexane-1,1-diol) |
|---|---|
| PubChem CID | 70538106 |
| Molecular Formula | C22H38O8 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;bis(4-methylhexane-1,1-diol) |
| SMILES | CCC(C)CCC(O)O.CCC(C)CCC(O)O.O=C(O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H6O4.2C7H16O2/c9-7(10)5-2-1-3-6(4-5)8(11)12;2*1-3-6(2)4-5-7(8)9/h1-4H,(H,9,10)(H,11,12);2*6-9H,3-5H2,1-2H3 |
| InChIKey | KJFNUMDWFRRTJE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|