C28H48O8 — CID 67537114
dibutyl benzene-1,2-dicarboxylate;2-methylpropanoic acid;2,2,4-trimethylpentane-1,3-diol (PubChem CID 67537114) has the molecular formula C28H48O8 and a molecular weight of 512.68 g/mol. Its IUPAC name is dibutyl benzene-1,2-dicarboxylate;2-methylpropanoic acid;2,2,4-trimethylpentane-1,3-diol.
| Compound Name | dibutyl benzene-1,2-dicarboxylate;2-methylpropanoic acid;2,2,4-trimethylpentane-1,3-diol |
|---|---|
| PubChem CID | 67537114 |
| Molecular Formula | C28H48O8 |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | dibutyl benzene-1,2-dicarboxylate;2-methylpropanoic acid;2,2,4-trimethylpentane-1,3-diol |
| SMILES | CC(C)C(=O)O.CC(C)C(O)C(C)(C)CO.CCCCOC(=O)c1ccccc1C(=O)OCCCC |
| InChI | InChI=1S/C16H22O4.C8H18O2.C4H8O2/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2;1-6(2)7(10)8(3,4)5-9;1-3(2)4(5)6/h7-10H,3-6,11-12H2,1-2H3;6-7,9-10H,5H2,1-4H3;3H,1-2H3,(H,5,6) |
| InChIKey | VCUZMGCSIJZWGN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|