C22H36O7 — CID 67593623
dibutyl benzene-1,2-dicarboxylate;2-ethyl-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 67593623) has the molecular formula C22H36O7 and a molecular weight of 412.52 g/mol. Its IUPAC name is dibutyl benzene-1,2-dicarboxylate;2-ethyl-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | dibutyl benzene-1,2-dicarboxylate;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 67593623 |
| Molecular Formula | C22H36O7 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | dibutyl benzene-1,2-dicarboxylate;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CCC(CO)(CO)CO.CCCCOC(=O)c1ccccc1C(=O)OCCCC |
| InChI | InChI=1S/C16H22O4.C6H14O3/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2;1-2-6(3-7,4-8)5-9/h7-10H,3-6,11-12H2,1-2H3;7-9H,2-5H2,1H3 |
| InChIKey | IXMYHMGAELRDCM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|