C16H32O6-2 — CID 53400269
bis(2-methylpropanoate);2,2,4-trimethylpentane-1,3-diol (PubChem CID 53400269) has the molecular formula C16H32O6-2 and a molecular weight of 320.43 g/mol. Its IUPAC name is bis(2-methylpropanoate);2,2,4-trimethylpentane-1,3-diol.
| Compound Name | bis(2-methylpropanoate);2,2,4-trimethylpentane-1,3-diol |
|---|---|
| PubChem CID | 53400269 |
| Molecular Formula | C16H32O6-2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | bis(2-methylpropanoate);2,2,4-trimethylpentane-1,3-diol |
| SMILES | CC(C)C(=O)[O-].CC(C)C(=O)[O-].CC(C)C(O)C(C)(C)CO |
| InChI | InChI=1S/C8H18O2.2C4H8O2/c1-6(2)7(10)8(3,4)5-9;2*1-3(2)4(5)6/h6-7,9-10H,5H2,1-4H3;2*3H,1-2H3,(H,5,6)/p-2 |
| InChIKey | JXOHZSPZKSGSBN-UHFFFAOYSA-L |
| XLogP | -0.19 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |