C7H13LiO4 — CID 23703538
lithium (3R)-3,5-dihydroxy-4,4-dimethylpentanoate (PubChem CID 23703538) has the molecular formula C7H13LiO4 and a molecular weight of 168.12 g/mol. Its IUPAC name is lithium (3R)-3,5-dihydroxy-4,4-dimethylpentanoate.
| Compound Name | lithium (3R)-3,5-dihydroxy-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 23703538 |
| Molecular Formula | C7H13LiO4 |
| Molecular Weight | 168.12 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | lithium (3R)-3,5-dihydroxy-4,4-dimethylpentanoate |
| SMILES | CC(C)(CO)[C@H](O)CC(=O)[O-].[Li+] |
| InChI | InChI=1S/C7H14O4.Li/c1-7(2,4-8)5(9)3-6(10)11;/h5,8-9H,3-4H2,1-2H3,(H,10,11);/q;+1/p-1/t5-;/m1./s1 |
| InChIKey | QFUVDDMQJVUOHZ-NUBCRITNSA-M |
| XLogP | -4.49 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.12 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |