C5H6CaO7 — CID 18704349
calcium 2,2,3-trihydroxypentanedioate (PubChem CID 18704349) has the molecular formula C5H6CaO7 and a molecular weight of 218.17 g/mol. Its IUPAC name is calcium 2,2,3-trihydroxypentanedioate.
| Compound Name | calcium 2,2,3-trihydroxypentanedioate |
|---|---|
| PubChem CID | 18704349 |
| Molecular Formula | C5H6CaO7 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | calcium 2,2,3-trihydroxypentanedioate |
| SMILES | O=C([O-])CC(O)C(O)(O)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C5H8O7.Ca/c6-2(1-3(7)8)5(11,12)4(9)10;/h2,6,11-12H,1H2,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChIKey | VUJZISGVRIYTIL-UHFFFAOYSA-L |
| XLogP | -5.46 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | -5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|