About 3-oxo-2-sulfanylbutanal
3-oxo-2-sulfanylbutanal (PubChem CID 18759412) has the molecular formula C4H6O2S
and a molecular weight of 118.16 g/mol. Its IUPAC name is 3-oxo-2-sulfanylbutanal.
Molecular Properties
| Compound Name | 3-oxo-2-sulfanylbutanal |
| PubChem CID | 18759412 |
| Molecular Formula | C4H6O2S |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.01 |
| IUPAC Name | 3-oxo-2-sulfanylbutanal |
| SMILES | CC(=O)C(S)C=O |
| InChI | InChI=1S/C4H6O2S/c1-3(6)4(7)2-5/h2,4,7H,1H3 |
| InChIKey | IEDPYBQHYLWNNQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-2-sulfanylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-2-sulfanylbutanal?
The IUPAC name of 3-oxo-2-sulfanylbutanal (CID 18759412) is 3-oxo-2-sulfanylbutanal.
What is the SMILES notation for 3-oxo-2-sulfanylbutanal?
The canonical SMILES for 3-oxo-2-sulfanylbutanal is CC(=O)C(S)C=O.
What is the InChIKey of 3-oxo-2-sulfanylbutanal?
The InChIKey is IEDPYBQHYLWNNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2S/c1-3(6)4(7)2-5/h2,4,7H,1H3.
What are the key properties of 3-oxo-2-sulfanylbutanal?
3-oxo-2-sulfanylbutanal has a molecular weight of 118.16 g/mol, XLogP of 0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-2-sulfanylbutanal is sourced from PubChem (CID 18759412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).