About lithium;2-chloro-3-oxobutanal;hydride
lithium;2-chloro-3-oxobutanal;hydride (PubChem CID 173414321) has the molecular formula C4H6ClLiO2
and a molecular weight of 128.48 g/mol. Its IUPAC name is lithium;2-chloro-3-oxobutanal;hydride.
Molecular Properties
| Compound Name | lithium;2-chloro-3-oxobutanal;hydride |
| PubChem CID | 173414321 |
| Molecular Formula | C4H6ClLiO2 |
| Molecular Weight | 128.48 g/mol |
| Exact Mass | 128.02 |
| IUPAC Name | lithium;2-chloro-3-oxobutanal;hydride |
| SMILES | CC(=O)C(Cl)C=O.[H-].[Li+] |
| InChI | InChI=1S/C4H5ClO2.Li.H/c1-3(7)4(5)2-6;;/h2,4H,1H3;;/q;+1;-1 |
| InChIKey | DMWRZBZOBJWIPP-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.48 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze lithium;2-chloro-3-oxobutanal;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2-chloro-3-oxobutanal;hydride?
The IUPAC name of lithium;2-chloro-3-oxobutanal;hydride (CID 173414321) is lithium;2-chloro-3-oxobutanal;hydride.
What is the SMILES notation for lithium;2-chloro-3-oxobutanal;hydride?
The canonical SMILES for lithium;2-chloro-3-oxobutanal;hydride is CC(=O)C(Cl)C=O.[H-].[Li+].
What is the InChIKey of lithium;2-chloro-3-oxobutanal;hydride?
The InChIKey is DMWRZBZOBJWIPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClO2.Li.H/c1-3(7)4(5)2-6;;/h2,4H,1H3;;/q;+1;-1.
What are the key properties of lithium;2-chloro-3-oxobutanal;hydride?
lithium;2-chloro-3-oxobutanal;hydride has a molecular weight of 128.48 g/mol, XLogP of -2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2-chloro-3-oxobutanal;hydride is sourced from PubChem (CID 173414321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).