About 2-formyl-3-oxobutanamide
2-formyl-3-oxobutanamide (PubChem CID 45085336) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is 2-formyl-3-oxobutanamide.
Molecular Properties
| Compound Name | 2-formyl-3-oxobutanamide |
| PubChem CID | 45085336 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 2-formyl-3-oxobutanamide |
| SMILES | CC(=O)C(C=O)C(N)=O |
| InChI | InChI=1S/C5H7NO3/c1-3(8)4(2-7)5(6)9/h2,4H,1H3,(H2,6,9) |
| InChIKey | GKXDCRDXPLHDFG-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-formyl-3-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formyl-3-oxobutanamide?
The IUPAC name of 2-formyl-3-oxobutanamide (CID 45085336) is 2-formyl-3-oxobutanamide.
What is the SMILES notation for 2-formyl-3-oxobutanamide?
The canonical SMILES for 2-formyl-3-oxobutanamide is CC(=O)C(C=O)C(N)=O.
What is the InChIKey of 2-formyl-3-oxobutanamide?
The InChIKey is GKXDCRDXPLHDFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3/c1-3(8)4(2-7)5(6)9/h2,4H,1H3,(H2,6,9).
What are the key properties of 2-formyl-3-oxobutanamide?
2-formyl-3-oxobutanamide has a molecular weight of 129.11 g/mol, XLogP of -1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formyl-3-oxobutanamide is sourced from PubChem (CID 45085336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).