About 2-acetyl-3-oxobutanal;rhodium
2-acetyl-3-oxobutanal;rhodium (PubChem CID 175459599) has the molecular formula C6H8O3Rh
and a molecular weight of 231.03 g/mol. Its IUPAC name is 2-acetyl-3-oxobutanal;rhodium.
Molecular Properties
| Compound Name | 2-acetyl-3-oxobutanal;rhodium |
| PubChem CID | 175459599 |
| Molecular Formula | C6H8O3Rh |
| Molecular Weight | 231.03 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 2-acetyl-3-oxobutanal;rhodium |
| SMILES | CC(=O)C(C=O)C(C)=O.[Rh] |
| InChI | InChI=1S/C6H8O3.Rh/c1-4(8)6(3-7)5(2)9;/h3,6H,1-2H3; |
| InChIKey | JFPZGTCFCRSDDV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.03 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-3-oxobutanal;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-3-oxobutanal;rhodium?
The IUPAC name of 2-acetyl-3-oxobutanal;rhodium (CID 175459599) is 2-acetyl-3-oxobutanal;rhodium.
What is the SMILES notation for 2-acetyl-3-oxobutanal;rhodium?
The canonical SMILES for 2-acetyl-3-oxobutanal;rhodium is CC(=O)C(C=O)C(C)=O.[Rh].
What is the InChIKey of 2-acetyl-3-oxobutanal;rhodium?
The InChIKey is JFPZGTCFCRSDDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3.Rh/c1-4(8)6(3-7)5(2)9;/h3,6H,1-2H3;.
What are the key properties of 2-acetyl-3-oxobutanal;rhodium?
2-acetyl-3-oxobutanal;rhodium has a molecular weight of 231.03 g/mol, XLogP of -0.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-3-oxobutanal;rhodium is sourced from PubChem (CID 175459599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).