C7H11NO2 — CID 7156894
3-(methyliminomethyl)pentane-2,4-dione (PubChem CID 7156894) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-(methyliminomethyl)pentane-2,4-dione.
| Compound Name | 3-(methyliminomethyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 7156894 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 3-(methyliminomethyl)pentane-2,4-dione |
| SMILES | C/N=C/C(C(C)=O)C(C)=O |
| InChI | InChI=1S/C7H11NO2/c1-5(9)7(4-8-3)6(2)10/h4,7H,1-3H3/b8-4+ |
| InChIKey | IJVGMUOROJFCTG-XBXARRHUSA-N |
| XLogP | 0.48 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|