About acetic acid;benzene;chloroform
acetic acid;benzene;chloroform (PubChem CID 161093060) has the molecular formula C9H11Cl3O2
and a molecular weight of 257.54 g/mol. Its IUPAC name is acetic acid;benzene;chloroform.
Molecular Properties
| Compound Name | acetic acid;benzene;chloroform |
| PubChem CID | 161093060 |
| Molecular Formula | C9H11Cl3O2 |
| Molecular Weight | 257.54 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | acetic acid;benzene;chloroform |
| SMILES | CC(=O)O.ClC(Cl)Cl.c1ccccc1 |
| InChI | InChI=1S/C6H6.C2H4O2.CHCl3/c1-2-4-6-5-3-1;1-2(3)4;2-1(3)4/h1-6H;1H3,(H,3,4);1H |
| InChIKey | UHKXQUPVCNAHOT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;benzene;chloroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;benzene;chloroform?
The IUPAC name of acetic acid;benzene;chloroform (CID 161093060) is acetic acid;benzene;chloroform.
What is the SMILES notation for acetic acid;benzene;chloroform?
The canonical SMILES for acetic acid;benzene;chloroform is CC(=O)O.ClC(Cl)Cl.c1ccccc1.
What is the InChIKey of acetic acid;benzene;chloroform?
The InChIKey is UHKXQUPVCNAHOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.C2H4O2.CHCl3/c1-2-4-6-5-3-1;1-2(3)4;2-1(3)4/h1-6H;1H3,(H,3,4);1H.
What are the key properties of acetic acid;benzene;chloroform?
acetic acid;benzene;chloroform has a molecular weight of 257.54 g/mol, XLogP of 3.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;benzene;chloroform is sourced from PubChem (CID 161093060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).