C16H26O10 — CID 87434570
(4R,5R,6R,7S)-4,6-diacetyl-3,4,5,6,7,8-hexahydroxy-5,7-dimethyldecane-2,9-dione (PubChem CID 87434570) has the molecular formula C16H26O10 and a molecular weight of 378.37 g/mol. Its IUPAC name is (4R,5R,6R,7S)-4,6-diacetyl-3,4,5,6,7,8-hexahydroxy-5,7-dimethyldecane-2,9-dione.
| Compound Name | (4R,5R,6R,7S)-4,6-diacetyl-3,4,5,6,7,8-hexahydroxy-5,7-dimethyldecane-2,9-dione |
|---|---|
| PubChem CID | 87434570 |
| Molecular Formula | C16H26O10 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (4R,5R,6R,7S)-4,6-diacetyl-3,4,5,6,7,8-hexahydroxy-5,7-dimethyldecane-2,9-dione |
| SMILES | CC(=O)C(O)[C@](C)(O)[C@](O)(C(C)=O)[C@](C)(O)[C@@](O)(C(C)=O)C(O)C(C)=O |
| InChI | InChI=1S/C16H26O10/c1-7(17)11(21)13(5,23)16(26,10(4)20)14(6,24)15(25,9(3)19)12(22)8(2)18/h11-12,21-26H,1-6H3/t11?,12?,13-,14+,15+,16+/m0/s1 |
| InChIKey | FXFDAYNOUDHHNT-OQMZOEMTSA-N |
| XLogP | -2.97 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |