C7H11Br3O5 — CID 154125261
5-bromo-4,4-bis[bromo(hydroxy)methyl]-3,5-dihydroxypentan-2-one (PubChem CID 154125261) has the molecular formula C7H11Br3O5 and a molecular weight of 414.87 g/mol. Its IUPAC name is 5-bromo-4,4-bis[bromo(hydroxy)methyl]-3,5-dihydroxypentan-2-one.
| Compound Name | 5-bromo-4,4-bis[bromo(hydroxy)methyl]-3,5-dihydroxypentan-2-one |
|---|---|
| PubChem CID | 154125261 |
| Molecular Formula | C7H11Br3O5 |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 411.82 |
| IUPAC Name | 5-bromo-4,4-bis[bromo(hydroxy)methyl]-3,5-dihydroxypentan-2-one |
| SMILES | CC(=O)C(O)C(C(O)Br)(C(O)Br)C(O)Br |
| InChI | InChI=1S/C7H11Br3O5/c1-2(11)3(12)7(4(8)13,5(9)14)6(10)15/h3-6,12-15H,1H3 |
| InChIKey | SPVIGZQOJFGYTJ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|