About carbanide;3-hydroxypentane-2,4-dione;nickel
carbanide;3-hydroxypentane-2,4-dione;nickel (PubChem CID 172555752) has the molecular formula C6H11NiO3-
and a molecular weight of 189.84 g/mol. Its IUPAC name is carbanide;3-hydroxypentane-2,4-dione;nickel.
Molecular Properties
| Compound Name | carbanide;3-hydroxypentane-2,4-dione;nickel |
| PubChem CID | 172555752 |
| Molecular Formula | C6H11NiO3- |
| Molecular Weight | 189.84 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | carbanide;3-hydroxypentane-2,4-dione;nickel |
| SMILES | CC(=O)C(O)C(C)=O.[CH3-].[Ni] |
| InChI | InChI=1S/C5H8O3.CH3.Ni/c1-3(6)5(8)4(2)7;;/h5,8H,1-2H3;1H3;/q;-1; |
| InChIKey | OPBTYSKWOUPAFL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.84 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;3-hydroxypentane-2,4-dione;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;3-hydroxypentane-2,4-dione;nickel?
The IUPAC name of carbanide;3-hydroxypentane-2,4-dione;nickel (CID 172555752) is carbanide;3-hydroxypentane-2,4-dione;nickel.
What is the SMILES notation for carbanide;3-hydroxypentane-2,4-dione;nickel?
The canonical SMILES for carbanide;3-hydroxypentane-2,4-dione;nickel is CC(=O)C(O)C(C)=O.[CH3-].[Ni].
What is the InChIKey of carbanide;3-hydroxypentane-2,4-dione;nickel?
The InChIKey is OPBTYSKWOUPAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.CH3.Ni/c1-3(6)5(8)4(2)7;;/h5,8H,1-2H3;1H3;/q;-1;.
What are the key properties of carbanide;3-hydroxypentane-2,4-dione;nickel?
carbanide;3-hydroxypentane-2,4-dione;nickel has a molecular weight of 189.84 g/mol, XLogP of -0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;3-hydroxypentane-2,4-dione;nickel is sourced from PubChem (CID 172555752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).