About carbanide;3-methanidylbutan-2-one;oxocobalt
carbanide;3-methanidylbutan-2-one;oxocobalt (PubChem CID 173489381) has the molecular formula C6H12CoO2-2
and a molecular weight of 175.09 g/mol. Its IUPAC name is carbanide;3-methanidylbutan-2-one;oxocobalt.
Molecular Properties
| Compound Name | carbanide;3-methanidylbutan-2-one;oxocobalt |
| PubChem CID | 173489381 |
| Molecular Formula | C6H12CoO2-2 |
| Molecular Weight | 175.09 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | carbanide;3-methanidylbutan-2-one;oxocobalt |
| SMILES | O=[Co].[CH2-]C(C)C(C)=O.[CH3-] |
| InChI | InChI=1S/C5H9O.CH3.Co.O/c1-4(2)5(3)6;;;/h4H,1H2,2-3H3;1H3;;/q2*-1;; |
| InChIKey | WOIDQBAPWQFHJK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.09 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;3-methanidylbutan-2-one;oxocobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;3-methanidylbutan-2-one;oxocobalt?
The IUPAC name of carbanide;3-methanidylbutan-2-one;oxocobalt (CID 173489381) is carbanide;3-methanidylbutan-2-one;oxocobalt.
What is the SMILES notation for carbanide;3-methanidylbutan-2-one;oxocobalt?
The canonical SMILES for carbanide;3-methanidylbutan-2-one;oxocobalt is O=[Co].[CH2-]C(C)C(C)=O.[CH3-].
What is the InChIKey of carbanide;3-methanidylbutan-2-one;oxocobalt?
The InChIKey is WOIDQBAPWQFHJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O.CH3.Co.O/c1-4(2)5(3)6;;;/h4H,1H2,2-3H3;1H3;;/q2*-1;;.
What are the key properties of carbanide;3-methanidylbutan-2-one;oxocobalt?
carbanide;3-methanidylbutan-2-one;oxocobalt has a molecular weight of 175.09 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;3-methanidylbutan-2-one;oxocobalt is sourced from PubChem (CID 173489381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).