About sodium 2-methanidylpropanoic acid
sodium 2-methanidylpropanoic acid (PubChem CID 21356888) has the molecular formula C4H7NaO2
and a molecular weight of 110.09 g/mol. Its IUPAC name is sodium 2-methanidylpropanoic acid.
Molecular Properties
| Compound Name | sodium 2-methanidylpropanoic acid |
| PubChem CID | 21356888 |
| Molecular Formula | C4H7NaO2 |
| Molecular Weight | 110.09 g/mol |
| Exact Mass | 110.03 |
| IUPAC Name | sodium 2-methanidylpropanoic acid |
| SMILES | [CH2-]C(C)C(=O)O.[Na+] |
| InChI | InChI=1S/C4H7O2.Na/c1-3(2)4(5)6;/h3H,1H2,2H3,(H,5,6);/q-1;+1 |
| InChIKey | LJWHOINUFHBLRO-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.09 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-methanidylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-methanidylpropanoic acid?
The IUPAC name of sodium 2-methanidylpropanoic acid (CID 21356888) is sodium 2-methanidylpropanoic acid.
What is the SMILES notation for sodium 2-methanidylpropanoic acid?
The canonical SMILES for sodium 2-methanidylpropanoic acid is [CH2-]C(C)C(=O)O.[Na+].
What is the InChIKey of sodium 2-methanidylpropanoic acid?
The InChIKey is LJWHOINUFHBLRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7O2.Na/c1-3(2)4(5)6;/h3H,1H2,2H3,(H,5,6);/q-1;+1.
What are the key properties of sodium 2-methanidylpropanoic acid?
sodium 2-methanidylpropanoic acid has a molecular weight of 110.09 g/mol, XLogP of -2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methanidylpropanoic acid is sourced from PubChem (CID 21356888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).