About carbanide;propan-2-one;vanadium(2+)
carbanide;propan-2-one;vanadium(2+) (PubChem CID 153454963) has the molecular formula C4H8OV
and a molecular weight of 123.05 g/mol. Its IUPAC name is carbanide;propan-2-one;vanadium(2+).
Molecular Properties
| Compound Name | carbanide;propan-2-one;vanadium(2+) |
| PubChem CID | 153454963 |
| Molecular Formula | C4H8OV |
| Molecular Weight | 123.05 g/mol |
| Exact Mass | 123.00 |
| IUPAC Name | carbanide;propan-2-one;vanadium(2+) |
| SMILES | [CH2-]C(C)=O.[CH3-].[V+2] |
| InChI | InChI=1S/C3H5O.CH3.V/c1-3(2)4;;/h1H2,2H3;1H3;/q2*-1;+2 |
| InChIKey | DISMZAVXNTWSQC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.05 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;propan-2-one;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;propan-2-one;vanadium(2+)?
The IUPAC name of carbanide;propan-2-one;vanadium(2+) (CID 153454963) is carbanide;propan-2-one;vanadium(2+).
What is the SMILES notation for carbanide;propan-2-one;vanadium(2+)?
The canonical SMILES for carbanide;propan-2-one;vanadium(2+) is [CH2-]C(C)=O.[CH3-].[V+2].
What is the InChIKey of carbanide;propan-2-one;vanadium(2+)?
The InChIKey is DISMZAVXNTWSQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5O.CH3.V/c1-3(2)4;;/h1H2,2H3;1H3;/q2*-1;+2.
What are the key properties of carbanide;propan-2-one;vanadium(2+)?
carbanide;propan-2-one;vanadium(2+) has a molecular weight of 123.05 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;propan-2-one;vanadium(2+) is sourced from PubChem (CID 153454963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).