About butan-2-one;propan-2-one;uranium
butan-2-one;propan-2-one;uranium (PubChem CID 160776251) has the molecular formula C7H13O2U-
and a molecular weight of 367.21 g/mol. Its IUPAC name is butan-2-one;propan-2-one;uranium.
Molecular Properties
| Compound Name | butan-2-one;propan-2-one;uranium |
| PubChem CID | 160776251 |
| Molecular Formula | C7H13O2U- |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | butan-2-one;propan-2-one;uranium |
| SMILES | CCC(C)=O.[CH2-]C(C)=O.[U] |
| InChI | InChI=1S/C4H8O.C3H5O.U/c1-3-4(2)5;1-3(2)4;/h3H2,1-2H3;1H2,2H3;/q;-1; |
| InChIKey | MCZZNMVKDOEOKM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;propan-2-one;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;propan-2-one;uranium?
The IUPAC name of butan-2-one;propan-2-one;uranium (CID 160776251) is butan-2-one;propan-2-one;uranium.
What is the SMILES notation for butan-2-one;propan-2-one;uranium?
The canonical SMILES for butan-2-one;propan-2-one;uranium is CCC(C)=O.[CH2-]C(C)=O.[U].
What is the InChIKey of butan-2-one;propan-2-one;uranium?
The InChIKey is MCZZNMVKDOEOKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C3H5O.U/c1-3-4(2)5;1-3(2)4;/h3H2,1-2H3;1H2,2H3;/q;-1;.
What are the key properties of butan-2-one;propan-2-one;uranium?
butan-2-one;propan-2-one;uranium has a molecular weight of 367.21 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;propan-2-one;uranium is sourced from PubChem (CID 160776251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).