About chloropalladium(1+);propan-2-one
chloropalladium(1+);propan-2-one (PubChem CID 11298563) has the molecular formula C3H5ClOPd
and a molecular weight of 198.94 g/mol. Its IUPAC name is chloropalladium(1+);propan-2-one.
Molecular Properties
| Compound Name | chloropalladium(1+);propan-2-one |
| PubChem CID | 11298563 |
| Molecular Formula | C3H5ClOPd |
| Molecular Weight | 198.94 g/mol |
| Exact Mass | 197.91 |
| IUPAC Name | chloropalladium(1+);propan-2-one |
| SMILES | Cl[Pd+].[CH2-]C(C)=O |
| InChI | InChI=1S/C3H5O.ClH.Pd/c1-3(2)4;;/h1H2,2H3;1H;/q-1;;+2/p-1 |
| InChIKey | DNOJVGUUPGKWPH-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.94 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chloropalladium(1+);propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloropalladium(1+);propan-2-one?
The IUPAC name of chloropalladium(1+);propan-2-one (CID 11298563) is chloropalladium(1+);propan-2-one.
What is the SMILES notation for chloropalladium(1+);propan-2-one?
The canonical SMILES for chloropalladium(1+);propan-2-one is Cl[Pd+].[CH2-]C(C)=O.
What is the InChIKey of chloropalladium(1+);propan-2-one?
The InChIKey is DNOJVGUUPGKWPH-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5O.ClH.Pd/c1-3(2)4;;/h1H2,2H3;1H;/q-1;;+2/p-1.
What are the key properties of chloropalladium(1+);propan-2-one?
chloropalladium(1+);propan-2-one has a molecular weight of 198.94 g/mol, XLogP of 1.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloropalladium(1+);propan-2-one is sourced from PubChem (CID 11298563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).