About dichlororuthenium;propan-2-one
dichlororuthenium;propan-2-one (PubChem CID 161370342) has the molecular formula C3H6Cl2ORu
and a molecular weight of 230.06 g/mol. Its IUPAC name is dichlororuthenium;propan-2-one.
Molecular Properties
| Compound Name | dichlororuthenium;propan-2-one |
| PubChem CID | 161370342 |
| Molecular Formula | C3H6Cl2ORu |
| Molecular Weight | 230.06 g/mol |
| Exact Mass | 229.88 |
| IUPAC Name | dichlororuthenium;propan-2-one |
| SMILES | CC(C)=O.Cl[Ru]Cl |
| InChI | InChI=1S/C3H6O.2ClH.Ru/c1-3(2)4;;;/h1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | VQJMVKRTHAQRSF-UHFFFAOYSA-L |
| XLogP | 1.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.06 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dichlororuthenium;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlororuthenium;propan-2-one?
The IUPAC name of dichlororuthenium;propan-2-one (CID 161370342) is dichlororuthenium;propan-2-one.
What is the SMILES notation for dichlororuthenium;propan-2-one?
The canonical SMILES for dichlororuthenium;propan-2-one is CC(C)=O.Cl[Ru]Cl.
What is the InChIKey of dichlororuthenium;propan-2-one?
The InChIKey is VQJMVKRTHAQRSF-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H6O.2ClH.Ru/c1-3(2)4;;;/h1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlororuthenium;propan-2-one?
dichlororuthenium;propan-2-one has a molecular weight of 230.06 g/mol, XLogP of 1.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichlororuthenium;propan-2-one is sourced from PubChem (CID 161370342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).