C12H22O7 — CID 175535268
3,4,5,6,7-pentahydroxy-4,5,6-trimethylnonane-2,8-dione (PubChem CID 175535268) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is 3,4,5,6,7-pentahydroxy-4,5,6-trimethylnonane-2,8-dione.
| Compound Name | 3,4,5,6,7-pentahydroxy-4,5,6-trimethylnonane-2,8-dione |
|---|---|
| PubChem CID | 175535268 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 3,4,5,6,7-pentahydroxy-4,5,6-trimethylnonane-2,8-dione |
| SMILES | CC(=O)C(O)C(C)(O)C(C)(O)C(C)(O)C(O)C(C)=O |
| InChI | InChI=1S/C12H22O7/c1-6(13)8(15)10(3,17)12(5,19)11(4,18)9(16)7(2)14/h8-9,15-19H,1-5H3 |
| InChIKey | WZMYTDXAHLCQNL-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |