C15H30O5 — CID 87681486
3,4,6,7-tetrahydroxy-2,2,3,7,8,8-hexamethylnonan-5-one (PubChem CID 87681486) has the molecular formula C15H30O5 and a molecular weight of 290.40 g/mol. Its IUPAC name is 3,4,6,7-tetrahydroxy-2,2,3,7,8,8-hexamethylnonan-5-one.
| Compound Name | 3,4,6,7-tetrahydroxy-2,2,3,7,8,8-hexamethylnonan-5-one |
|---|---|
| PubChem CID | 87681486 |
| Molecular Formula | C15H30O5 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 3,4,6,7-tetrahydroxy-2,2,3,7,8,8-hexamethylnonan-5-one |
| SMILES | CC(C)(C)C(C)(O)C(O)C(=O)C(O)C(C)(O)C(C)(C)C |
| InChI | InChI=1S/C15H30O5/c1-12(2,3)14(7,19)10(17)9(16)11(18)15(8,20)13(4,5)6/h10-11,17-20H,1-8H3 |
| InChIKey | BFKDMWUBYOXBMG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |