C11H22O3 — CID 58488534
3,5-dihydroxy-2,2,6,6-tetramethylheptan-4-one (PubChem CID 58488534) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 3,5-dihydroxy-2,2,6,6-tetramethylheptan-4-one.
| Compound Name | 3,5-dihydroxy-2,2,6,6-tetramethylheptan-4-one |
|---|---|
| PubChem CID | 58488534 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 3,5-dihydroxy-2,2,6,6-tetramethylheptan-4-one |
| SMILES | CC(C)(C)C(O)C(=O)C(O)C(C)(C)C |
| InChI | InChI=1S/C11H22O3/c1-10(2,3)8(13)7(12)9(14)11(4,5)6/h8-9,13-14H,1-6H3 |
| InChIKey | MVOCRHRXPAMPAE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |