C17H32O2 — CID 19371353
5-tert-butyl-3,7-diethylnonane-4,6-dione (PubChem CID 19371353) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 5-tert-butyl-3,7-diethylnonane-4,6-dione.
| Compound Name | 5-tert-butyl-3,7-diethylnonane-4,6-dione |
|---|---|
| PubChem CID | 19371353 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 5-tert-butyl-3,7-diethylnonane-4,6-dione |
| SMILES | CCC(CC)C(=O)C(C(=O)C(CC)CC)C(C)(C)C |
| InChI | InChI=1S/C17H32O2/c1-8-12(9-2)15(18)14(17(5,6)7)16(19)13(10-3)11-4/h12-14H,8-11H2,1-7H3 |
| InChIKey | OYXVGRIATXDYRK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|