C14H19FO9 — CID 140529207
(3R,4R,5R)-2,2,3,4-tetraacetyl-3,4,5,6-tetrahydroxyhexanoyl fluoride (PubChem CID 140529207) has the molecular formula C14H19FO9 and a molecular weight of 350.30 g/mol. Its IUPAC name is (3R,4R,5R)-2,2,3,4-tetraacetyl-3,4,5,6-tetrahydroxyhexanoyl fluoride.
| Compound Name | (3R,4R,5R)-2,2,3,4-tetraacetyl-3,4,5,6-tetrahydroxyhexanoyl fluoride |
|---|---|
| PubChem CID | 140529207 |
| Molecular Formula | C14H19FO9 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (3R,4R,5R)-2,2,3,4-tetraacetyl-3,4,5,6-tetrahydroxyhexanoyl fluoride |
| SMILES | CC(=O)C(C(C)=O)(C(=O)F)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@H](O)CO |
| InChI | InChI=1S/C14H19FO9/c1-6(17)12(7(2)18,11(15)22)14(24,9(4)20)13(23,8(3)19)10(21)5-16/h10,16,21,23-24H,5H2,1-4H3/t10-,13-,14-/m1/s1 |
| InChIKey | XEZXABJRHKSRBI-LERXQTSPSA-N |
| XLogP | -2.36 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|